C14H19NO3 — CID 22578230
6-methoxy-N-propyl-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 22578230) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-methoxy-N-propyl-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 6-methoxy-N-propyl-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 22578230 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 6-methoxy-N-propyl-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CCCNC(=O)C1COc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C14H19NO3/c1-3-6-15-14(16)11-7-10-8-12(17-2)4-5-13(10)18-9-11/h4-5,8,11H,3,6-7,9H2,1-2H3,(H,15,16) |
| InChIKey | SOFJYFNDNKAUDX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |