C19H23N3O3 — CID 97124753
(3S)-7-methoxy-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 97124753) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3S)-7-methoxy-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-7-methoxy-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 97124753 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3S)-7-methoxy-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)OC[C@@H](C(=O)NCCNc1cc(C)ccn1)C2 |
| InChI | InChI=1S/C19H23N3O3/c1-13-5-6-20-18(9-13)21-7-8-22-19(23)15-10-14-3-4-16(24-2)11-17(14)25-12-15/h3-6,9,11,15H,7-8,10,12H2,1-2H3,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | IOQUIRUBCGUQCR-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|