C19H25N5O3 — CID 135109599
1-(3-methoxybenzoyl)-N-[3-(triazol-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 135109599) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(3-methoxybenzoyl)-N-[3-(triazol-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(3-methoxybenzoyl)-N-[3-(triazol-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 135109599 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(3-methoxybenzoyl)-N-[3-(triazol-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(C(=O)N2CCC(C(=O)NCCCn3ccnn3)CC2)c1 |
| InChI | InChI=1S/C19H25N5O3/c1-27-17-5-2-4-16(14-17)19(26)23-11-6-15(7-12-23)18(25)20-8-3-10-24-13-9-21-22-24/h2,4-5,9,13-15H,3,6-8,10-12H2,1H3,(H,20,25) |
| InChIKey | MUWLATUCPMCRDL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|