C13H13N5OS — CID 157017238
N-[3-(triazol-1-yl)propyl]-1,3-benzothiazole-7-carboxamide (PubChem CID 157017238) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[3-(triazol-1-yl)propyl]-1,3-benzothiazole-7-carboxamide.
| Compound Name | N-[3-(triazol-1-yl)propyl]-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 157017238 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-[3-(triazol-1-yl)propyl]-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(NCCCn1ccnn1)c1cccc2ncsc12 |
| InChI | InChI=1S/C13H13N5OS/c19-13(14-5-2-7-18-8-6-16-17-18)10-3-1-4-11-12(10)20-9-15-11/h1,3-4,6,8-9H,2,5,7H2,(H,14,19) |
| InChIKey | CKJBYQZNZUYRFP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|