C12H14N4OS — CID 107034799
3-sulfanyl-N-[3-(triazol-1-yl)propyl]benzamide (PubChem CID 107034799) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 3-sulfanyl-N-[3-(triazol-1-yl)propyl]benzamide.
| Compound Name | 3-sulfanyl-N-[3-(triazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 107034799 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-sulfanyl-N-[3-(triazol-1-yl)propyl]benzamide |
| SMILES | O=C(NCCCn1ccnn1)c1cccc(S)c1 |
| InChI | InChI=1S/C12H14N4OS/c17-12(10-3-1-4-11(18)9-10)13-5-2-7-16-8-6-14-15-16/h1,3-4,6,8-9,18H,2,5,7H2,(H,13,17) |
| InChIKey | RIRDJGKMEXZKJU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|