C18H21N5O — CID 72916863
2,3,6-trimethyl-N-[3-(triazol-1-yl)propyl]quinoline-4-carboxamide (PubChem CID 72916863) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 2,3,6-trimethyl-N-[3-(triazol-1-yl)propyl]quinoline-4-carboxamide.
| Compound Name | 2,3,6-trimethyl-N-[3-(triazol-1-yl)propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 72916863 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2,3,6-trimethyl-N-[3-(triazol-1-yl)propyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(C)c(C)c(C(=O)NCCCn3ccnn3)c2c1 |
| InChI | InChI=1S/C18H21N5O/c1-12-5-6-16-15(11-12)17(13(2)14(3)21-16)18(24)19-7-4-9-23-10-8-20-22-23/h5-6,8,10-11H,4,7,9H2,1-3H3,(H,19,24) |
| InChIKey | XADGVFLSPLPPGP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|