C20H25N3O2 — CID 97274873
N-[(3R)-1-acetylpiperidin-3-yl]-2,3,6-trimethylquinoline-4-carboxamide (PubChem CID 97274873) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(3R)-1-acetylpiperidin-3-yl]-2,3,6-trimethylquinoline-4-carboxamide.
| Compound Name | N-[(3R)-1-acetylpiperidin-3-yl]-2,3,6-trimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 97274873 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[(3R)-1-acetylpiperidin-3-yl]-2,3,6-trimethylquinoline-4-carboxamide |
| SMILES | CC(=O)N1CCC[C@@H](NC(=O)c2c(C)c(C)nc3ccc(C)cc23)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-12-7-8-18-17(10-12)19(13(2)14(3)21-18)20(25)22-16-6-5-9-23(11-16)15(4)24/h7-8,10,16H,5-6,9,11H2,1-4H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | LVLLVKMBLGEPLL-MRXNPFEDSA-N |
| XLogP | 2.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |