C11H11BrN4OS — CID 107034780
4-bromo-2-sulfanyl-N-[2-(triazol-1-yl)ethyl]benzamide (PubChem CID 107034780) has the molecular formula C11H11BrN4OS and a molecular weight of 327.21 g/mol. Its IUPAC name is 4-bromo-2-sulfanyl-N-[2-(triazol-1-yl)ethyl]benzamide.
| Compound Name | 4-bromo-2-sulfanyl-N-[2-(triazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107034780 |
| Molecular Formula | C11H11BrN4OS |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 4-bromo-2-sulfanyl-N-[2-(triazol-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1ccnn1)c1ccc(Br)cc1S |
| InChI | InChI=1S/C11H11BrN4OS/c12-8-1-2-9(10(18)7-8)11(17)13-3-5-16-6-4-14-15-16/h1-2,4,6-7,18H,3,5H2,(H,13,17) |
| InChIKey | REJVBHCTUXRXAM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|