C15H18F2N4O2 — CID 51085276
1-[4-(difluoromethoxy)phenyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea (PubChem CID 51085276) has the molecular formula C15H18F2N4O2 and a molecular weight of 324.33 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 51085276 |
| Molecular Formula | C15H18F2N4O2 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea |
| SMILES | Cc1nccn1CCCNC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H18F2N4O2/c1-11-18-8-10-21(11)9-2-7-19-15(22)20-12-3-5-13(6-4-12)23-14(16)17/h3-6,8,10,14H,2,7,9H2,1H3,(H2,19,20,22) |
| InChIKey | GKQNOCKCLSLBLR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|