C10H14N6OS2 — CID 118398328
1-[3-(2-methylimidazol-1-yl)propyl]-3-(5-sulfanylidene-2H-thiadiazol-4-yl)urea (PubChem CID 118398328) has the molecular formula C10H14N6OS2 and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-[3-(2-methylimidazol-1-yl)propyl]-3-(5-sulfanylidene-2H-thiadiazol-4-yl)urea.
| Compound Name | 1-[3-(2-methylimidazol-1-yl)propyl]-3-(5-sulfanylidene-2H-thiadiazol-4-yl)urea |
|---|---|
| PubChem CID | 118398328 |
| Molecular Formula | C10H14N6OS2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[3-(2-methylimidazol-1-yl)propyl]-3-(5-sulfanylidene-2H-thiadiazol-4-yl)urea |
| SMILES | Cc1nccn1CCCNC(=O)Nc1n[nH]sc1=S |
| InChI | InChI=1S/C10H14N6OS2/c1-7-11-4-6-16(7)5-2-3-12-10(17)13-8-9(18)19-15-14-8/h4,6,15H,2-3,5H2,1H3,(H2,12,13,14,17) |
| InChIKey | XQLNTXUIGSQOAY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|