C17H30N4O2 — CID 111507214
1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-methylimidazol-1-yl)butyl]urea (PubChem CID 111507214) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-methylimidazol-1-yl)butyl]urea.
| Compound Name | 1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-methylimidazol-1-yl)butyl]urea |
|---|---|
| PubChem CID | 111507214 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-methylimidazol-1-yl)butyl]urea |
| SMILES | Cc1nccn1CCCCNC(=O)NCC1(O)CCCCCC1 |
| InChI | InChI=1S/C17H30N4O2/c1-15-18-11-13-21(15)12-7-6-10-19-16(22)20-14-17(23)8-4-2-3-5-9-17/h11,13,23H,2-10,12,14H2,1H3,(H2,19,20,22) |
| InChIKey | WPXSPOPOYSCIJL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|