C18H29N3O3 — CID 111426906
1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-oxo-1-pyridinyl)butyl]urea (PubChem CID 111426906) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-oxo-1-pyridinyl)butyl]urea.
| Compound Name | 1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-oxo-1-pyridinyl)butyl]urea |
|---|---|
| PubChem CID | 111426906 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-[(1-hydroxycycloheptyl)methyl]-3-[4-(2-oxo-1-pyridinyl)butyl]urea |
| SMILES | O=C(NCCCCn1ccccc1=O)NCC1(O)CCCCCC1 |
| InChI | InChI=1S/C18H29N3O3/c22-16-9-3-7-13-21(16)14-8-6-12-19-17(23)20-15-18(24)10-4-1-2-5-11-18/h3,7,9,13,24H,1-2,4-6,8,10-12,14-15H2,(H2,19,20,23) |
| InChIKey | WTYUFFPFFPKXRQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|