C20H34IN5O2 — CID 111571896
N,N-dimethyl-1-[[[N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide (PubChem CID 111571896) has the molecular formula C20H34IN5O2 and a molecular weight of 503.43 g/mol. Its IUPAC name is N,N-dimethyl-1-[[[N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide.
| Compound Name | N,N-dimethyl-1-[[[N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111571896 |
| Molecular Formula | C20H34IN5O2 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N,N-dimethyl-1-[[[N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCCn1ccccc1=O)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C20H33N5O2.HI/c1-21-19(22-13-7-9-15-25-14-8-4-10-17(25)26)23-16-20(11-5-6-12-20)18(27)24(2)3;/h4,8,10,14H,5-7,9,11-13,15-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | NTUCTPKKCLBHIK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|