C20H32ClIN4O — CID 111571844
1-[[[N-[3-(4-chlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111571844) has the molecular formula C20H32ClIN4O and a molecular weight of 506.86 g/mol. Its IUPAC name is 1-[[[N-[3-(4-chlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-[3-(4-chlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111571844 |
| Molecular Formula | C20H32ClIN4O |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-[[[N-[3-(4-chlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCc1ccc(Cl)cc1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C20H31ClN4O.HI/c1-22-19(23-14-6-7-16-8-10-17(21)11-9-16)24-15-20(12-4-5-13-20)18(26)25(2)3;/h8-11H,4-7,12-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | MNQFTHWONPGXSX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|