C19H29F2IN4O — CID 111572184
1-[[[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111572184) has the molecular formula C19H29F2IN4O and a molecular weight of 494.37 g/mol. Its IUPAC name is 1-[[[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111572184 |
| Molecular Formula | C19H29F2IN4O |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 1-[[[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCc1c(F)cccc1F)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C19H28F2N4O.HI/c1-22-18(23-12-9-14-15(20)7-6-8-16(14)21)24-13-19(10-4-5-11-19)17(26)25(2)3;/h6-8H,4-5,9-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | NSVMYODNYIYBHQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|