C12H20N4O — CID 75526639
1,2-dimethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine (PubChem CID 75526639) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 1,2-dimethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
|---|---|
| PubChem CID | 75526639 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,2-dimethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
| SMILES | C/N=C(\NC)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C12H20N4O/c1-13-12(14-2)15-8-4-6-10-16-9-5-3-7-11(16)17/h3,5,7,9H,4,6,8,10H2,1-2H3,(H2,13,14,15) |
| InChIKey | CFQZCUIUXRIBBG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|