C16H23IN4OS — CID 111258226
2-methyl-1-[4-(2-oxo-1-pyridinyl)butyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111258226) has the molecular formula C16H23IN4OS and a molecular weight of 446.36 g/mol. Its IUPAC name is 2-methyl-1-[4-(2-oxo-1-pyridinyl)butyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[4-(2-oxo-1-pyridinyl)butyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258226 |
| Molecular Formula | C16H23IN4OS |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-methyl-1-[4-(2-oxo-1-pyridinyl)butyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCn1ccccc1=O)NCc1cccs1.I |
| InChI | InChI=1S/C16H22N4OS.HI/c1-17-16(19-13-14-7-6-12-22-14)18-9-3-5-11-20-10-4-2-8-15(20)21;/h2,4,6-8,10,12H,3,5,9,11,13H2,1H3,(H2,17,18,19);1H |
| InChIKey | MHWGOGVFPBRAEA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|