C15H24N4O — CID 111083567
2-(cyclobutylmethyl)-1-[4-(2-oxo-1-pyridinyl)butyl]guanidine (PubChem CID 111083567) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[4-(2-oxo-1-pyridinyl)butyl]guanidine.
| Compound Name | 2-(cyclobutylmethyl)-1-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
|---|---|
| PubChem CID | 111083567 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
| SMILES | N/C(=N\CC1CCC1)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C15H24N4O/c16-15(18-12-13-6-5-7-13)17-9-2-4-11-19-10-3-1-8-14(19)20/h1,3,8,10,13H,2,4-7,9,11-12H2,(H3,16,17,18) |
| InChIKey | ZJMOXRSUKKJGPG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|