C13H21N3O2S — CID 111596929
N-[(3-hydroxythiolan-3-yl)methyl]-4-(2-methylimidazol-1-yl)butanamide (PubChem CID 111596929) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[(3-hydroxythiolan-3-yl)methyl]-4-(2-methylimidazol-1-yl)butanamide.
| Compound Name | N-[(3-hydroxythiolan-3-yl)methyl]-4-(2-methylimidazol-1-yl)butanamide |
|---|---|
| PubChem CID | 111596929 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[(3-hydroxythiolan-3-yl)methyl]-4-(2-methylimidazol-1-yl)butanamide |
| SMILES | Cc1nccn1CCCC(=O)NCC1(O)CCSC1 |
| InChI | InChI=1S/C13H21N3O2S/c1-11-14-5-7-16(11)6-2-3-12(17)15-9-13(18)4-8-19-10-13/h5,7,18H,2-4,6,8-10H2,1H3,(H,15,17) |
| InChIKey | SZWAXYZNWJJMSG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |