C15H26N4OS — CID 97074746
1-[4-(2-methylimidazol-1-yl)butyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea (PubChem CID 97074746) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-[4-(2-methylimidazol-1-yl)butyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea.
| Compound Name | 1-[4-(2-methylimidazol-1-yl)butyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97074746 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[4-(2-methylimidazol-1-yl)butyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
| SMILES | Cc1nccn1CCCCNC(=O)NC[C@@]1(C)CCCS1 |
| InChI | InChI=1S/C15H26N4OS/c1-13-16-8-10-19(13)9-4-3-7-17-14(20)18-12-15(2)6-5-11-21-15/h8,10H,3-7,9,11-12H2,1-2H3,(H2,17,18,20)/t15-/m1/s1 |
| InChIKey | JIPYAGZKIRQDCI-OAHLLOKOSA-N |
| XLogP | 2.56 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|