C16H28N4O2 — CID 95930538
1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea (PubChem CID 95930538) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea.
| Compound Name | 1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 95930538 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[3-(2-methylimidazol-1-yl)propyl]urea |
| SMILES | CO[C@@]1(C)C[C@@H](NC(=O)NCCCn2ccnc2C)C1(C)C |
| InChI | InChI=1S/C16H28N4O2/c1-12-17-8-10-20(12)9-6-7-18-14(21)19-13-11-16(4,22-5)15(13,2)3/h8,10,13H,6-7,9,11H2,1-5H3,(H2,18,19,21)/t13-,16+/m1/s1 |
| InChIKey | UQKSSMGXKXGBBX-CJNGLKHVSA-N |
| XLogP | 2.08 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|