C15H26N4O2 — CID 95909004
1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 95909004) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 95909004 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | CO[C@@]1(C)C[C@@H](NC(=O)NCCCn2cccn2)C1(C)C |
| InChI | InChI=1S/C15H26N4O2/c1-14(2)12(11-15(14,3)21-4)18-13(20)16-7-5-9-19-10-6-8-17-19/h6,8,10,12H,5,7,9,11H2,1-4H3,(H2,16,18,20)/t12-,15+/m1/s1 |
| InChIKey | NFLROEYKNNYHBQ-DOMZBBRYSA-N |
| XLogP | 1.78 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|