C9H13F3N4O — CID 113223590
1-(3-pyrazol-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113223590) has the molecular formula C9H13F3N4O and a molecular weight of 250.22 g/mol. Its IUPAC name is 1-(3-pyrazol-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-pyrazol-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113223590 |
| Molecular Formula | C9H13F3N4O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-(3-pyrazol-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCCCn1cccn1)NCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N4O/c10-9(11,12)7-14-8(17)13-3-1-5-16-6-2-4-15-16/h2,4,6H,1,3,5,7H2,(H2,13,14,17) |
| InChIKey | DZKPTQJZCUOUGN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|