C15H24N6O — CID 86931524
1-(3-pyrazol-1-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea (PubChem CID 86931524) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(3-pyrazol-1-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-(3-pyrazol-1-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 86931524 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(3-pyrazol-1-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
| SMILES | Cc1nn(C)c(C)c1CCNC(=O)NCCCn1cccn1 |
| InChI | InChI=1S/C15H24N6O/c1-12-14(13(2)20(3)19-12)6-9-17-15(22)16-7-4-10-21-11-5-8-18-21/h5,8,11H,4,6-7,9-10H2,1-3H3,(H2,16,17,22) |
| InChIKey | WACAZQCDDCPJTI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|