C14H15F3N4OS — CID 87010339
1-(3-pyrazol-1-ylpropyl)-3-[2-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 87010339) has the molecular formula C14H15F3N4OS and a molecular weight of 344.36 g/mol. Its IUPAC name is 1-(3-pyrazol-1-ylpropyl)-3-[2-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-(3-pyrazol-1-ylpropyl)-3-[2-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 87010339 |
| Molecular Formula | C14H15F3N4OS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-(3-pyrazol-1-ylpropyl)-3-[2-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(NCCCn1cccn1)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C14H15F3N4OS/c15-14(16,17)23-12-6-2-1-5-11(12)20-13(22)18-7-3-9-21-10-4-8-19-21/h1-2,4-6,8,10H,3,7,9H2,(H2,18,20,22) |
| InChIKey | ZRWXQTCLHQQGSS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|