C19H24N6O — CID 118773217
1-[3-(2-ethylimidazol-1-yl)propyl]-3-[4-(2-methylimidazol-1-yl)phenyl]urea (PubChem CID 118773217) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[3-(2-ethylimidazol-1-yl)propyl]-3-[4-(2-methylimidazol-1-yl)phenyl]urea.
| Compound Name | 1-[3-(2-ethylimidazol-1-yl)propyl]-3-[4-(2-methylimidazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 118773217 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[3-(2-ethylimidazol-1-yl)propyl]-3-[4-(2-methylimidazol-1-yl)phenyl]urea |
| SMILES | CCc1nccn1CCCNC(=O)Nc1ccc(-n2ccnc2C)cc1 |
| InChI | InChI=1S/C19H24N6O/c1-3-18-21-10-13-24(18)12-4-9-22-19(26)23-16-5-7-17(8-6-16)25-14-11-20-15(25)2/h5-8,10-11,13-14H,3-4,9,12H2,1-2H3,(H2,22,23,26) |
| InChIKey | RRKSWPLEHCLWBZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|