C18H23N5O3 — CID 74239820
1-[3-(2-ethylimidazol-1-yl)propyl]-3-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)urea (PubChem CID 74239820) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[3-(2-ethylimidazol-1-yl)propyl]-3-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)urea.
| Compound Name | 1-[3-(2-ethylimidazol-1-yl)propyl]-3-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 74239820 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-[3-(2-ethylimidazol-1-yl)propyl]-3-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)urea |
| SMILES | CCc1nccn1CCCNC(=O)Nc1ccc2c(c1)oc(=O)n2CC |
| InChI | InChI=1S/C18H23N5O3/c1-3-16-19-9-11-22(16)10-5-8-20-17(24)21-13-6-7-14-15(12-13)26-18(25)23(14)4-2/h6-7,9,11-12H,3-5,8,10H2,1-2H3,(H2,20,21,24) |
| InChIKey | MFLMINPAYYSDDB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|