C18H19N3O4 — CID 50796782
1-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 50796782) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 50796782 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | CCn1c(=O)oc2cc(NC(=O)NCc3cccc(OC)c3)ccc21 |
| InChI | InChI=1S/C18H19N3O4/c1-3-21-15-8-7-13(10-16(15)25-18(21)23)20-17(22)19-11-12-5-4-6-14(9-12)24-2/h4-10H,3,11H2,1-2H3,(H2,19,20,22) |
| InChIKey | YZJCVRUHXLZTJH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |