C20H23N3O3 — CID 38234162
1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 38234162) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 38234162 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)Nc2ccc3oc(C(C)(C)C)nc3c2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-20(2,3)18-23-16-11-14(8-9-17(16)26-18)22-19(24)21-12-13-6-5-7-15(10-13)25-4/h5-11H,12H2,1-4H3,(H2,21,22,24) |
| InChIKey | JIWWTJQBRFRFAE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |