C16H21N3O4 — CID 126821455
1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-(1,3-dioxolan-4-ylmethyl)urea (PubChem CID 126821455) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-(1,3-dioxolan-4-ylmethyl)urea.
| Compound Name | 1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-(1,3-dioxolan-4-ylmethyl)urea |
|---|---|
| PubChem CID | 126821455 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(2-tert-butyl-1,3-benzoxazol-5-yl)-3-(1,3-dioxolan-4-ylmethyl)urea |
| SMILES | CC(C)(C)c1nc2cc(NC(=O)NCC3COCO3)ccc2o1 |
| InChI | InChI=1S/C16H21N3O4/c1-16(2,3)14-19-12-6-10(4-5-13(12)23-14)18-15(20)17-7-11-8-21-9-22-11/h4-6,11H,7-9H2,1-3H3,(H2,17,18,20) |
| InChIKey | OBEVWFIYGMUREF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |