C12H15N5O3 — CID 125157213
1-(2H-benzotriazol-5-yl)-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea (PubChem CID 125157213) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-(2H-benzotriazol-5-yl)-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea.
| Compound Name | 1-(2H-benzotriazol-5-yl)-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 125157213 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-(2H-benzotriazol-5-yl)-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1COCCO1)Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C12H15N5O3/c18-12(13-6-9-7-19-3-4-20-9)14-8-1-2-10-11(5-8)16-17-15-10/h1-2,5,9H,3-4,6-7H2,(H2,13,14,18)(H,15,16,17)/t9-/m0/s1 |
| InChIKey | SHMNAHIIQWABJF-VIFPVBQESA-N |
| XLogP | 0.49 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |