C15H21N3O5 — CID 94653303
ethyl N-[4-[[(2S)-1,4-dioxan-2-yl]methylcarbamoylamino]phenyl]carbamate (PubChem CID 94653303) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is ethyl N-[4-[[(2S)-1,4-dioxan-2-yl]methylcarbamoylamino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[(2S)-1,4-dioxan-2-yl]methylcarbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 94653303 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethyl N-[4-[[(2S)-1,4-dioxan-2-yl]methylcarbamoylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC(=O)NC[C@H]2COCCO2)cc1 |
| InChI | InChI=1S/C15H21N3O5/c1-2-22-15(20)18-12-5-3-11(4-6-12)17-14(19)16-9-13-10-21-7-8-23-13/h3-6,13H,2,7-10H2,1H3,(H,18,20)(H2,16,17,19)/t13-/m0/s1 |
| InChIKey | BNKJJXGZVJTEDH-ZDUSSCGKSA-N |
| XLogP | 1.79 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |