C19H22N2O5 — CID 94652910
1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[4-(2-methoxyphenoxy)phenyl]urea (PubChem CID 94652910) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[4-(2-methoxyphenoxy)phenyl]urea.
| Compound Name | 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[4-(2-methoxyphenoxy)phenyl]urea |
|---|---|
| PubChem CID | 94652910 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[4-(2-methoxyphenoxy)phenyl]urea |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)NC[C@@H]2COCCO2)cc1 |
| InChI | InChI=1S/C19H22N2O5/c1-23-17-4-2-3-5-18(17)26-15-8-6-14(7-9-15)21-19(22)20-12-16-13-24-10-11-25-16/h2-9,16H,10-13H2,1H3,(H2,20,21,22)/t16-/m1/s1 |
| InChIKey | NTWYFCGWOYYNDC-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |