C19H19F3N2O3 — CID 94655499
1-[[(2S)-1,4-dioxan-2-yl]methyl]-3-[4-phenyl-3-(trifluoromethyl)phenyl]urea (PubChem CID 94655499) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 1-[[(2S)-1,4-dioxan-2-yl]methyl]-3-[4-phenyl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[(2S)-1,4-dioxan-2-yl]methyl]-3-[4-phenyl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 94655499 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[[(2S)-1,4-dioxan-2-yl]methyl]-3-[4-phenyl-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NC[C@H]1COCCO1)Nc1ccc(-c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)17-10-14(6-7-16(17)13-4-2-1-3-5-13)24-18(25)23-11-15-12-26-8-9-27-15/h1-7,10,15H,8-9,11-12H2,(H2,23,24,25)/t15-/m0/s1 |
| InChIKey | VTEQGKBLHBUSGD-HNNXBMFYSA-N |
| XLogP | 3.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |