C14H22N4O5S — CID 125180090
1-[3-(dimethylsulfamoylamino)phenyl]-3-[[(2R)-1,4-dioxan-2-yl]methyl]urea (PubChem CID 125180090) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoylamino)phenyl]-3-[[(2R)-1,4-dioxan-2-yl]methyl]urea.
| Compound Name | 1-[3-(dimethylsulfamoylamino)phenyl]-3-[[(2R)-1,4-dioxan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 125180090 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-[3-(dimethylsulfamoylamino)phenyl]-3-[[(2R)-1,4-dioxan-2-yl]methyl]urea |
| SMILES | CN(C)S(=O)(=O)Nc1cccc(NC(=O)NC[C@@H]2COCCO2)c1 |
| InChI | InChI=1S/C14H22N4O5S/c1-18(2)24(20,21)17-12-5-3-4-11(8-12)16-14(19)15-9-13-10-22-6-7-23-13/h3-5,8,13,17H,6-7,9-10H2,1-2H3,(H2,15,16,19)/t13-/m1/s1 |
| InChIKey | YQFSJEGLZVKBHI-CYBMUJFWSA-N |
| XLogP | 0.44 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |