C13H18N2O5S — CID 94652752
1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-(4-methylsulfonylphenyl)urea (PubChem CID 94652752) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-(4-methylsulfonylphenyl)urea.
| Compound Name | 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-(4-methylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 94652752 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-(4-methylsulfonylphenyl)urea |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)NC[C@@H]2COCCO2)cc1 |
| InChI | InChI=1S/C13H18N2O5S/c1-21(17,18)12-4-2-10(3-5-12)15-13(16)14-8-11-9-19-6-7-20-11/h2-5,11H,6-9H2,1H3,(H2,14,15,16)/t11-/m1/s1 |
| InChIKey | ICUUOFHHXSTAAX-LLVKDONJSA-N |
| XLogP | 0.63 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |