4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid

C14H18N2O5 — CID 61209023

IUPAC4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1NC(=O)NCC1COCCO1
InChIInChI=1S/C14H18N2O5/c1-9-6-10(13(17)18)2-3-12(9)16-14(19)15-7-11-8-20-4-5-21-11/h2-3,6,11H,4-5,7-8H2,1H3,(H,17,18)(H2,15,16,19)
InChIKeyFTSZKXHZGNCKFO-UHFFFAOYSA-N
MW294.31 g/mol
LogP1.23
Rot. Bonds4

About 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid

4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid (PubChem CID 61209023) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid.

Molecular Properties

Compound Name4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid
PubChem CID61209023
Molecular FormulaC14H18N2O5
Molecular Weight294.31 g/mol
Exact Mass294.12
IUPAC Name4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1NC(=O)NCC1COCCO1
InChIInChI=1S/C14H18N2O5/c1-9-6-10(13(17)18)2-3-12(9)16-14(19)15-7-11-8-20-4-5-21-11/h2-3,6,11H,4-5,7-8H2,1H3,(H,17,18)(H2,15,16,19)
InChIKeyFTSZKXHZGNCKFO-UHFFFAOYSA-N
XLogP1.23
TPSA96.89 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.31
LogP ≤ 51.23
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid?
The IUPAC name of 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid (CID 61209023) is 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid.
What is the SMILES notation for 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid?
The canonical SMILES for 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid is Cc1cc(C(=O)O)ccc1NC(=O)NCC1COCCO1.
What is the InChIKey of 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid?
The InChIKey is FTSZKXHZGNCKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O5/c1-9-6-10(13(17)18)2-3-12(9)16-14(19)15-7-11-8-20-4-5-21-11/h2-3,6,11H,4-5,7-8H2,1H3,(H,17,18)(H2,15,16,19).
What are the key properties of 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid?
4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid has a molecular weight of 294.31 g/mol, XLogP of 1.23, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dioxan-2-ylmethylcarbamoylamino)-3-methylbenzoic acid is sourced from PubChem (CID 61209023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).