C15H18N4O3 — CID 125161615
1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea (PubChem CID 125161615) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea.
| Compound Name | 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 125161615 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[[(2R)-1,4-dioxan-2-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
| SMILES | O=C(NC[C@@H]1COCCO1)Nc1cccc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C15H18N4O3/c20-15(16-9-13-10-21-6-7-22-13)18-12-3-1-2-11(8-12)14-4-5-17-19-14/h1-5,8,13H,6-7,9-10H2,(H,17,19)(H2,16,18,20)/t13-/m1/s1 |
| InChIKey | JQSQDTZJFBNQRG-CYBMUJFWSA-N |
| XLogP | 1.61 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |