C19H22N2O5 — CID 99783925
ethyl 2-[4-[(3-methoxyphenyl)methylcarbamoylamino]phenoxy]acetate (PubChem CID 99783925) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 2-[4-[(3-methoxyphenyl)methylcarbamoylamino]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(3-methoxyphenyl)methylcarbamoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 99783925 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | ethyl 2-[4-[(3-methoxyphenyl)methylcarbamoylamino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC(=O)NCc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C19H22N2O5/c1-3-25-18(22)13-26-16-9-7-15(8-10-16)21-19(23)20-12-14-5-4-6-17(11-14)24-2/h4-11H,3,12-13H2,1-2H3,(H2,20,21,23) |
| InChIKey | GGYJHSPLIJMJAE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |