C20H24N4O4 — CID 55697379
2-[4-[(3-acetamidophenyl)methylcarbamoylamino]phenoxy]-N-ethylacetamide (PubChem CID 55697379) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[4-[(3-acetamidophenyl)methylcarbamoylamino]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[4-[(3-acetamidophenyl)methylcarbamoylamino]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 55697379 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[4-[(3-acetamidophenyl)methylcarbamoylamino]phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)NCc2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C20H24N4O4/c1-3-21-19(26)13-28-18-9-7-16(8-10-18)24-20(27)22-12-15-5-4-6-17(11-15)23-14(2)25/h4-11H,3,12-13H2,1-2H3,(H,21,26)(H,23,25)(H2,22,24,27) |
| InChIKey | GWHPHAXLNAUDFE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |