C18H23N7O — CID 72924769
1-[3-(2-ethylimidazol-1-yl)propyl]-3-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]urea (PubChem CID 72924769) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is 1-[3-(2-ethylimidazol-1-yl)propyl]-3-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]urea.
| Compound Name | 1-[3-(2-ethylimidazol-1-yl)propyl]-3-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 72924769 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-[3-(2-ethylimidazol-1-yl)propyl]-3-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]urea |
| SMILES | CCc1nccn1CCCNC(=O)Nc1cccc(-c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C18H23N7O/c1-3-16-19-9-11-25(16)10-5-8-20-18(26)22-15-7-4-6-14(12-15)17-21-13(2)23-24-17/h4,6-7,9,11-12H,3,5,8,10H2,1-2H3,(H2,20,22,26)(H,21,23,24) |
| InChIKey | VGHGXSYBEJPTSH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|