C17H24N4O — CID 60552910
N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]octanamide (PubChem CID 60552910) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]octanamide.
| Compound Name | N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]octanamide |
|---|---|
| PubChem CID | 60552910 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1cccc(-c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C17H24N4O/c1-3-4-5-6-7-11-16(22)19-15-10-8-9-14(12-15)17-18-13(2)20-21-17/h8-10,12H,3-7,11H2,1-2H3,(H,19,22)(H,18,20,21) |
| InChIKey | FWIKORSSNKLBLV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|