C13H17N5O — CID 54862667
2-amino-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide (PubChem CID 54862667) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-amino-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide.
| Compound Name | 2-amino-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 54862667 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-amino-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide |
| SMILES | CCC(N)C(=O)Nc1cccc(-c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C13H17N5O/c1-3-11(14)13(19)16-10-6-4-5-9(7-10)12-15-8(2)17-18-12/h4-7,11H,3,14H2,1-2H3,(H,16,19)(H,15,17,18) |
| InChIKey | YEPOOKOIILSHJA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |