C12H14N4O2 — CID 60911506
2-methoxy-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]acetamide (PubChem CID 60911506) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-methoxy-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]acetamide.
| Compound Name | 2-methoxy-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 60911506 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-methoxy-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]acetamide |
| SMILES | COCC(=O)Nc1cccc(-c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C12H14N4O2/c1-8-13-12(16-15-8)9-4-3-5-10(6-9)14-11(17)7-18-2/h3-6H,7H2,1-2H3,(H,14,17)(H,13,15,16) |
| InChIKey | CPCWIKMZDCUERV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |