C16H24N4 — CID 60935756
N-heptyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 60935756) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N-heptyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | N-heptyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 60935756 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-heptyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | CCCCCCCNc1cccc(-c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C16H24N4/c1-3-4-5-6-7-11-17-15-10-8-9-14(12-15)16-18-13(2)19-20-16/h8-10,12,17H,3-7,11H2,1-2H3,(H,18,19,20) |
| InChIKey | HNMTZPSOJUXLGM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|