C19H22N4O2 — CID 90556407
1-(4-ethoxyphenyl)-3-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)urea (PubChem CID 90556407) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 90556407 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCCCn2ccc3cccnc32)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-2-25-17-8-6-16(7-9-17)22-19(24)21-12-4-13-23-14-10-15-5-3-11-20-18(15)23/h3,5-11,14H,2,4,12-13H2,1H3,(H2,21,22,24) |
| InChIKey | RWGQOIIAKCPVPA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|