C18H17F3N4O — CID 90556420
1-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 90556420) has the molecular formula C18H17F3N4O and a molecular weight of 362.36 g/mol. Its IUPAC name is 1-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90556420 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCCn1ccc2cccnc21)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N4O/c19-18(20,21)14-5-1-6-15(12-14)24-17(26)23-9-3-10-25-11-7-13-4-2-8-22-16(13)25/h1-2,4-8,11-12H,3,9-10H2,(H2,23,24,26) |
| InChIKey | ZUGXJUKBEQJVIH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|