C22H19F3N6O — CID 50788173
1-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 50788173) has the molecular formula C22H19F3N6O and a molecular weight of 440.43 g/mol. Its IUPAC name is 1-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 50788173 |
| Molecular Formula | C22H19F3N6O |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCCn1c(-c2ccncc2)nc2cccnc21)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F3N6O/c23-22(24,25)16-4-1-5-17(14-16)29-21(32)28-10-3-13-31-19(15-7-11-26-12-8-15)30-18-6-2-9-27-20(18)31/h1-2,4-9,11-12,14H,3,10,13H2,(H2,28,29,32) |
| InChIKey | JMTCRJVJZQKBED-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|