C21H19ClN6O — CID 50788153
1-(4-chlorophenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea (PubChem CID 50788153) has the molecular formula C21H19ClN6O and a molecular weight of 406.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea |
|---|---|
| PubChem CID | 50788153 |
| Molecular Formula | C21H19ClN6O |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea |
| SMILES | O=C(NCCCn1c(-c2ccncc2)nc2cccnc21)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN6O/c22-16-4-6-17(7-5-16)26-21(29)25-11-2-14-28-19(15-8-12-23-13-9-15)27-18-3-1-10-24-20(18)28/h1,3-10,12-13H,2,11,14H2,(H2,25,26,29) |
| InChIKey | FAYHDRIQCDTFLX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|