C23H24N6O3 — CID 46331611
1-(3,5-dimethoxyphenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea (PubChem CID 46331611) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea |
|---|---|
| PubChem CID | 46331611 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[3-(2-pyridin-4-ylimidazo[4,5-b]pyridin-3-yl)propyl]urea |
| SMILES | COc1cc(NC(=O)NCCCn2c(-c3ccncc3)nc3cccnc32)cc(OC)c1 |
| InChI | InChI=1S/C23H24N6O3/c1-31-18-13-17(14-19(15-18)32-2)27-23(30)26-9-4-12-29-21(16-6-10-24-11-7-16)28-20-5-3-8-25-22(20)29/h3,5-8,10-11,13-15H,4,9,12H2,1-2H3,(H2,26,27,30) |
| InChIKey | IVXPPYGPOGWQEH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|